rel-(2R,3S)-2-(methoxymethyl)-1-methyl-N-(4-methylphenyl)-6-oxopiperidine-3-carboxamide
Chemical Structure Depiction of
rel-(2R,3S)-2-(methoxymethyl)-1-methyl-N-(4-methylphenyl)-6-oxopiperidine-3-carboxamide
rel-(2R,3S)-2-(methoxymethyl)-1-methyl-N-(4-methylphenyl)-6-oxopiperidine-3-carboxamide
Compound characteristics
| Compound ID: | S760-0224 |
| Compound Name: | rel-(2R,3S)-2-(methoxymethyl)-1-methyl-N-(4-methylphenyl)-6-oxopiperidine-3-carboxamide |
| Molecular Weight: | 290.36 |
| Molecular Formula: | C16 H22 N2 O3 |
| Smiles: | Cc1ccc(cc1)NC([C@@H]1CCC(N(C)[C@@H]1COC)=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 1.3019 |
| logD: | 1.3019 |
| logSw: | -2.5217 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.977 |
| InChI Key: | SIRKKYCGUWTHIJ-KGLIPLIRSA-N |