2-methyl-1-{4-[2-(5-methyl-2-phenyl-1H-imidazol-1-yl)ethyl]piperidin-1-yl}propan-1-one
Chemical Structure Depiction of
2-methyl-1-{4-[2-(5-methyl-2-phenyl-1H-imidazol-1-yl)ethyl]piperidin-1-yl}propan-1-one
2-methyl-1-{4-[2-(5-methyl-2-phenyl-1H-imidazol-1-yl)ethyl]piperidin-1-yl}propan-1-one
Compound characteristics
| Compound ID: | S776-1607 |
| Compound Name: | 2-methyl-1-{4-[2-(5-methyl-2-phenyl-1H-imidazol-1-yl)ethyl]piperidin-1-yl}propan-1-one |
| Molecular Weight: | 339.48 |
| Molecular Formula: | C21 H29 N3 O |
| Smiles: | CC(C)C(N1CCC(CC1)CCn1c(C)cnc1c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.142 |
| logD: | 4.1278 |
| logSw: | -4.0223 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.0499 |
| InChI Key: | VQROQTJMODKUGE-UHFFFAOYSA-N |