{3-[(5-methyl-2-phenyl-1H-imidazol-1-yl)methyl]pyrrolidin-1-yl}(5-methylpyrazin-2-yl)methanone
Chemical Structure Depiction of
{3-[(5-methyl-2-phenyl-1H-imidazol-1-yl)methyl]pyrrolidin-1-yl}(5-methylpyrazin-2-yl)methanone
{3-[(5-methyl-2-phenyl-1H-imidazol-1-yl)methyl]pyrrolidin-1-yl}(5-methylpyrazin-2-yl)methanone
Compound characteristics
| Compound ID: | S779-0078 |
| Compound Name: | {3-[(5-methyl-2-phenyl-1H-imidazol-1-yl)methyl]pyrrolidin-1-yl}(5-methylpyrazin-2-yl)methanone |
| Molecular Weight: | 361.45 |
| Molecular Formula: | C21 H23 N5 O |
| Smiles: | Cc1cnc(cn1)C(N1CCC(C1)Cn1c(C)cnc1c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7299 |
| logD: | 2.7169 |
| logSw: | -2.7165 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.181 |
| InChI Key: | BAXKMLZDVQCJDJ-QGZVFWFLSA-N |