3-(4-{[1-(cyclopentylacetyl)piperidin-4-yl]methyl}phenyl)-N,N-dimethylpropanamide
Chemical Structure Depiction of
3-(4-{[1-(cyclopentylacetyl)piperidin-4-yl]methyl}phenyl)-N,N-dimethylpropanamide
3-(4-{[1-(cyclopentylacetyl)piperidin-4-yl]methyl}phenyl)-N,N-dimethylpropanamide
Compound characteristics
| Compound ID: | S787-0693 |
| Compound Name: | 3-(4-{[1-(cyclopentylacetyl)piperidin-4-yl]methyl}phenyl)-N,N-dimethylpropanamide |
| Molecular Weight: | 384.56 |
| Molecular Formula: | C24 H36 N2 O2 |
| Smiles: | CN(C)C(CCc1ccc(CC2CCN(CC2)C(CC2CCCC2)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.828 |
| logD: | 3.828 |
| logSw: | -3.962 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.119 |
| InChI Key: | AAJZVFYSIABXTB-UHFFFAOYSA-N |