3-{[rel-(8aR,11aS)-8-oxododecahydro-1H-cyclopenta[b][1,5]diazecin-1-yl]methyl}benzonitrile
Chemical Structure Depiction of
3-{[rel-(8aR,11aS)-8-oxododecahydro-1H-cyclopenta[b][1,5]diazecin-1-yl]methyl}benzonitrile
3-{[rel-(8aR,11aS)-8-oxododecahydro-1H-cyclopenta[b][1,5]diazecin-1-yl]methyl}benzonitrile
Compound characteristics
| Compound ID: | S788-0160 |
| Compound Name: | 3-{[rel-(8aR,11aS)-8-oxododecahydro-1H-cyclopenta[b][1,5]diazecin-1-yl]methyl}benzonitrile |
| Molecular Weight: | 311.43 |
| Molecular Formula: | C19 H25 N3 O |
| Smiles: | C1CCNC([C@@H]2CCC[C@@H]2N(CC1)Cc1cccc(C#N)c1)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 1.8618 |
| logD: | 1.7629 |
| logSw: | -2.5901 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.18 |
| InChI Key: | OITAHSLKDLNQLQ-MSOLQXFVSA-N |