8-[(3-fluorophenyl)methyl]-1-oxa-4,8-diazacycloundecan-5-one
Chemical Structure Depiction of
8-[(3-fluorophenyl)methyl]-1-oxa-4,8-diazacycloundecan-5-one
8-[(3-fluorophenyl)methyl]-1-oxa-4,8-diazacycloundecan-5-one
Compound characteristics
| Compound ID: | S789-0164 |
| Compound Name: | 8-[(3-fluorophenyl)methyl]-1-oxa-4,8-diazacycloundecan-5-one |
| Molecular Weight: | 280.34 |
| Molecular Formula: | C15 H21 F N2 O2 |
| Smiles: | C1CN(CCC(NCCOC1)=O)Cc1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 0.9751 |
| logD: | 0.4664 |
| logSw: | -1.9368 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.234 |
| InChI Key: | KIUWUJQWSOCGKE-UHFFFAOYSA-N |