2-(2,5-dimethoxyphenyl)-1-[2-(1-ethyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)piperidin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(2,5-dimethoxyphenyl)-1-[2-(1-ethyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)piperidin-1-yl]ethan-1-one
2-(2,5-dimethoxyphenyl)-1-[2-(1-ethyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)piperidin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | S892-0825 |
| Compound Name: | 2-(2,5-dimethoxyphenyl)-1-[2-(1-ethyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)piperidin-1-yl]ethan-1-one |
| Molecular Weight: | 413.52 |
| Molecular Formula: | C23 H31 N3 O4 |
| Smiles: | CCn1c2CCOCc2c(C2CCCCN2C(Cc2cc(ccc2OC)OC)=O)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7903 |
| logD: | 2.7903 |
| logSw: | -3.0168 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.74 |
| InChI Key: | NRSRJOXLEFBFRH-FQEVSTJZSA-N |