1-[4-cyano-3-(trifluoromethyl)phenyl]-4-(cyclohexylacetyl)piperazine-2-carboxamide
Chemical Structure Depiction of
1-[4-cyano-3-(trifluoromethyl)phenyl]-4-(cyclohexylacetyl)piperazine-2-carboxamide
1-[4-cyano-3-(trifluoromethyl)phenyl]-4-(cyclohexylacetyl)piperazine-2-carboxamide
Compound characteristics
| Compound ID: | S951-0071 |
| Compound Name: | 1-[4-cyano-3-(trifluoromethyl)phenyl]-4-(cyclohexylacetyl)piperazine-2-carboxamide |
| Molecular Weight: | 422.45 |
| Molecular Formula: | C21 H25 F3 N4 O2 |
| Smiles: | C1CCC(CC1)CC(N1CCN(C(C1)C(N)=O)c1ccc(C#N)c(c1)C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9647 |
| logD: | 2.9647 |
| logSw: | -3.345 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.554 |
| InChI Key: | PRYXXURGEBLQEX-SFHVURJKSA-N |