1-[4-cyano-3-(trifluoromethyl)phenyl]-4-(1H-indole-6-carbonyl)-N-methylpiperazine-2-carboxamide
Chemical Structure Depiction of
1-[4-cyano-3-(trifluoromethyl)phenyl]-4-(1H-indole-6-carbonyl)-N-methylpiperazine-2-carboxamide
1-[4-cyano-3-(trifluoromethyl)phenyl]-4-(1H-indole-6-carbonyl)-N-methylpiperazine-2-carboxamide
Compound characteristics
| Compound ID: | S951-0204 |
| Compound Name: | 1-[4-cyano-3-(trifluoromethyl)phenyl]-4-(1H-indole-6-carbonyl)-N-methylpiperazine-2-carboxamide |
| Molecular Weight: | 455.44 |
| Molecular Formula: | C23 H20 F3 N5 O2 |
| Smiles: | CNC(C1CN(CCN1c1ccc(C#N)c(c1)C(F)(F)F)C(c1ccc2cc[nH]c2c1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4096 |
| logD: | 2.4096 |
| logSw: | -3.1285 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.447 |
| InChI Key: | YLPZURFCDQFLOP-FQEVSTJZSA-N |