1-[4-cyano-3-(trifluoromethyl)phenyl]-N-methyl-4-[3-(1H-pyrazol-1-yl)propanoyl]piperazine-2-carboxamide
Chemical Structure Depiction of
1-[4-cyano-3-(trifluoromethyl)phenyl]-N-methyl-4-[3-(1H-pyrazol-1-yl)propanoyl]piperazine-2-carboxamide
1-[4-cyano-3-(trifluoromethyl)phenyl]-N-methyl-4-[3-(1H-pyrazol-1-yl)propanoyl]piperazine-2-carboxamide
Compound characteristics
| Compound ID: | S951-0311 |
| Compound Name: | 1-[4-cyano-3-(trifluoromethyl)phenyl]-N-methyl-4-[3-(1H-pyrazol-1-yl)propanoyl]piperazine-2-carboxamide |
| Molecular Weight: | 434.42 |
| Molecular Formula: | C20 H21 F3 N6 O2 |
| Smiles: | CNC(C1CN(CCN1c1ccc(C#N)c(c1)C(F)(F)F)C(CCn1cccn1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.5394 |
| logD: | 0.5394 |
| logSw: | -2.2173 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.911 |
| InChI Key: | KWIPMQVNBGREKJ-KRWDZBQOSA-N |