4-[4-cyano-3-(trifluoromethyl)phenyl]-N,N-dimethyl-1-(thiophene-3-carbonyl)piperazine-2-carboxamide
Chemical Structure Depiction of
4-[4-cyano-3-(trifluoromethyl)phenyl]-N,N-dimethyl-1-(thiophene-3-carbonyl)piperazine-2-carboxamide
4-[4-cyano-3-(trifluoromethyl)phenyl]-N,N-dimethyl-1-(thiophene-3-carbonyl)piperazine-2-carboxamide
Compound characteristics
| Compound ID: | S951-5616 |
| Compound Name: | 4-[4-cyano-3-(trifluoromethyl)phenyl]-N,N-dimethyl-1-(thiophene-3-carbonyl)piperazine-2-carboxamide |
| Molecular Weight: | 436.45 |
| Molecular Formula: | C20 H19 F3 N4 O2 S |
| Smiles: | CN(C)C(C1CN(CCN1C(c1ccsc1)=O)c1ccc(C#N)c(c1)C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1696 |
| logD: | 2.1696 |
| logSw: | -2.8834 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 53.85 |
| InChI Key: | BYMYBOIELTZYMZ-KRWDZBQOSA-N |