8-[4-cyano-3-(trifluoromethyl)phenyl]-N-methyl-2-(4-methyl-1,3-oxazole-5-carbonyl)-2,8-diazaspiro[4.5]decane-4-carboxamide
Chemical Structure Depiction of
8-[4-cyano-3-(trifluoromethyl)phenyl]-N-methyl-2-(4-methyl-1,3-oxazole-5-carbonyl)-2,8-diazaspiro[4.5]decane-4-carboxamide
8-[4-cyano-3-(trifluoromethyl)phenyl]-N-methyl-2-(4-methyl-1,3-oxazole-5-carbonyl)-2,8-diazaspiro[4.5]decane-4-carboxamide
Compound characteristics
| Compound ID: | S952-0242 |
| Compound Name: | 8-[4-cyano-3-(trifluoromethyl)phenyl]-N-methyl-2-(4-methyl-1,3-oxazole-5-carbonyl)-2,8-diazaspiro[4.5]decane-4-carboxamide |
| Molecular Weight: | 475.47 |
| Molecular Formula: | C23 H24 F3 N5 O3 |
| Smiles: | Cc1c(C(N2CC(C(NC)=O)C3(CCN(CC3)c3ccc(C#N)c(c3)C(F)(F)F)C2)=O)ocn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.143 |
| logD: | 1.143 |
| logSw: | -2.4243 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.106 |
| InChI Key: | WBYYJSWXSDAKNV-GOSISDBHSA-N |