2-[4-cyano-3-(trifluoromethyl)phenyl]-8-(cyclopentylacetyl)-N-methyl-2,8-diazaspiro[4.5]decane-4-carboxamide
Chemical Structure Depiction of
2-[4-cyano-3-(trifluoromethyl)phenyl]-8-(cyclopentylacetyl)-N-methyl-2,8-diazaspiro[4.5]decane-4-carboxamide
2-[4-cyano-3-(trifluoromethyl)phenyl]-8-(cyclopentylacetyl)-N-methyl-2,8-diazaspiro[4.5]decane-4-carboxamide
Compound characteristics
| Compound ID: | S952-5246 |
| Compound Name: | 2-[4-cyano-3-(trifluoromethyl)phenyl]-8-(cyclopentylacetyl)-N-methyl-2,8-diazaspiro[4.5]decane-4-carboxamide |
| Molecular Weight: | 476.54 |
| Molecular Formula: | C25 H31 F3 N4 O2 |
| Smiles: | CNC(C1CN(CC12CCN(CC2)C(CC1CCCC1)=O)c1ccc(C#N)c(c1)C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6545 |
| logD: | 2.6545 |
| logSw: | -3.1183 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.223 |
| InChI Key: | FJKLZPMGXKBKOP-NRFANRHFSA-N |