1-{4-[rel-(3R,4R)-1-(cyclopropylmethyl)-4-(phenoxymethyl)pyrrolidin-3-yl]piperidin-1-yl}ethan-1-one
Chemical Structure Depiction of
1-{4-[rel-(3R,4R)-1-(cyclopropylmethyl)-4-(phenoxymethyl)pyrrolidin-3-yl]piperidin-1-yl}ethan-1-one
1-{4-[rel-(3R,4R)-1-(cyclopropylmethyl)-4-(phenoxymethyl)pyrrolidin-3-yl]piperidin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | S995-0690 |
| Compound Name: | 1-{4-[rel-(3R,4R)-1-(cyclopropylmethyl)-4-(phenoxymethyl)pyrrolidin-3-yl]piperidin-1-yl}ethan-1-one |
| Molecular Weight: | 356.51 |
| Molecular Formula: | C22 H32 N2 O2 |
| Smiles: | CC(N1CCC(CC1)[C@@H]1CN(CC2CC2)C[C@H]1COc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 3.5263 |
| logD: | 0.1084 |
| logSw: | -3.3612 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.0708 |
| InChI Key: | PGKANBMZJTXHFV-IFMALSPDSA-N |