(2,5-difluorophenyl){3-(dimethylamino)-3-[1-(2-methoxyethyl)-1H-tetrazol-5-yl]pyrrolidin-1-yl}methanone
Chemical Structure Depiction of
(2,5-difluorophenyl){3-(dimethylamino)-3-[1-(2-methoxyethyl)-1H-tetrazol-5-yl]pyrrolidin-1-yl}methanone
(2,5-difluorophenyl){3-(dimethylamino)-3-[1-(2-methoxyethyl)-1H-tetrazol-5-yl]pyrrolidin-1-yl}methanone
Compound characteristics
| Compound ID: | SA21-0026 |
| Compound Name: | (2,5-difluorophenyl){3-(dimethylamino)-3-[1-(2-methoxyethyl)-1H-tetrazol-5-yl]pyrrolidin-1-yl}methanone |
| Molecular Weight: | 380.4 |
| Molecular Formula: | C17 H22 F2 N6 O2 |
| Smiles: | CN(C)C1(CCN(C1)C(c1cc(ccc1F)F)=O)c1nnnn1CCOC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.1234 |
| logD: | 1.1232 |
| logSw: | -2.2573 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 67.14 |
| InChI Key: | OLINWSJAKWEQKL-KRWDZBQOSA-N |