(3,5-dimethyl-1,2-oxazol-4-yl)[6-methyl-7-(5-phenyl-1,3,4-oxadiazol-2-yl)-2,6-diazaspiro[3.4]octan-2-yl]methanone
Chemical Structure Depiction of
(3,5-dimethyl-1,2-oxazol-4-yl)[6-methyl-7-(5-phenyl-1,3,4-oxadiazol-2-yl)-2,6-diazaspiro[3.4]octan-2-yl]methanone
(3,5-dimethyl-1,2-oxazol-4-yl)[6-methyl-7-(5-phenyl-1,3,4-oxadiazol-2-yl)-2,6-diazaspiro[3.4]octan-2-yl]methanone
Compound characteristics
| Compound ID: | SA44-0797 |
| Compound Name: | (3,5-dimethyl-1,2-oxazol-4-yl)[6-methyl-7-(5-phenyl-1,3,4-oxadiazol-2-yl)-2,6-diazaspiro[3.4]octan-2-yl]methanone |
| Molecular Weight: | 393.44 |
| Molecular Formula: | C21 H23 N5 O3 |
| Smiles: | Cc1c(C(N2CC3(CC(c4nnc(c5ccccc5)o4)N(C)C3)C2)=O)c(C)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.622 |
| logD: | 0.9616 |
| logSw: | -1.9464 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 72.974 |
| InChI Key: | QRSHPRVVLPNFBM-MRXNPFEDSA-N |