2-methyl-9-[(2-oxo-1,3-benzoxazol-3(2H)-yl)acetyl]-2,9-diazaspiro[5.5]undecane-1-carboxamide
Chemical Structure Depiction of
2-methyl-9-[(2-oxo-1,3-benzoxazol-3(2H)-yl)acetyl]-2,9-diazaspiro[5.5]undecane-1-carboxamide
2-methyl-9-[(2-oxo-1,3-benzoxazol-3(2H)-yl)acetyl]-2,9-diazaspiro[5.5]undecane-1-carboxamide
Compound characteristics
| Compound ID: | SA45-0071 |
| Compound Name: | 2-methyl-9-[(2-oxo-1,3-benzoxazol-3(2H)-yl)acetyl]-2,9-diazaspiro[5.5]undecane-1-carboxamide |
| Molecular Weight: | 386.45 |
| Molecular Formula: | C20 H26 N4 O4 |
| Smiles: | CN1CCCC2(CCN(CC2)C(CN2C(=O)Oc3ccccc23)=O)C1C(N)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.4016 |
| logD: | -1.204 |
| logSw: | -1.4743 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.649 |
| InChI Key: | CDXNBPSFSVIGIH-QGZVFWFLSA-N |