1-{7-[benzyl(methyl)amino]-5-oxa-2-azaspiro[3.4]octan-2-yl}-2-(4-methoxyphenyl)ethan-1-one
Chemical Structure Depiction of
1-{7-[benzyl(methyl)amino]-5-oxa-2-azaspiro[3.4]octan-2-yl}-2-(4-methoxyphenyl)ethan-1-one
1-{7-[benzyl(methyl)amino]-5-oxa-2-azaspiro[3.4]octan-2-yl}-2-(4-methoxyphenyl)ethan-1-one
Compound characteristics
| Compound ID: | SA46-2181 |
| Compound Name: | 1-{7-[benzyl(methyl)amino]-5-oxa-2-azaspiro[3.4]octan-2-yl}-2-(4-methoxyphenyl)ethan-1-one |
| Molecular Weight: | 380.49 |
| Molecular Formula: | C23 H28 N2 O3 |
| Smiles: | CN(Cc1ccccc1)C1CC2(CN(C2)C(Cc2ccc(cc2)OC)=O)OC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8657 |
| logD: | 2.7134 |
| logSw: | -3.1057 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 34.162 |
| InChI Key: | PLYANUPRVPGZQO-HXUWFJFHSA-N |