4-(2-acetamidoethyl)-N-(2-chloro-4-methylphenyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide
Chemical Structure Depiction of
4-(2-acetamidoethyl)-N-(2-chloro-4-methylphenyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide
4-(2-acetamidoethyl)-N-(2-chloro-4-methylphenyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide
Compound characteristics
| Compound ID: | SA63-1102 |
| Compound Name: | 4-(2-acetamidoethyl)-N-(2-chloro-4-methylphenyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide |
| Molecular Weight: | 407.94 |
| Molecular Formula: | C21 H30 Cl N3 O3 |
| Smiles: | CC(NCCC1CCOC2(CCN(CC2)C(Nc2ccc(C)cc2[Cl])=O)C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.872 |
| logD: | 2.8719 |
| logSw: | -3.4178 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.037 |
| InChI Key: | CWUCVBRSTRXLEK-QGZVFWFLSA-N |