N-{[9-(3-chloro-4-fluorobenzoyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]methyl}pyridine-3-carboxamide
Chemical Structure Depiction of
N-{[9-(3-chloro-4-fluorobenzoyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]methyl}pyridine-3-carboxamide
N-{[9-(3-chloro-4-fluorobenzoyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]methyl}pyridine-3-carboxamide
Compound characteristics
| Compound ID: | SA64-1146 |
| Compound Name: | N-{[9-(3-chloro-4-fluorobenzoyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]methyl}pyridine-3-carboxamide |
| Molecular Weight: | 445.92 |
| Molecular Formula: | C23 H25 Cl F N3 O3 |
| Smiles: | C1COC2(CCN(CC2)C(c2ccc(c(c2)[Cl])F)=O)CC1CNC(c1cccnc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1414 |
| logD: | 2.1414 |
| logSw: | -3.2633 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.42 |
| InChI Key: | VVFRDZZCFQCBIN-MRXNPFEDSA-N |