1,3-dimethyl-N-{[5-oxo-4-(2-phenylethyl)morpholin-2-yl]methyl}-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
1,3-dimethyl-N-{[5-oxo-4-(2-phenylethyl)morpholin-2-yl]methyl}-1H-pyrazole-5-carboxamide
1,3-dimethyl-N-{[5-oxo-4-(2-phenylethyl)morpholin-2-yl]methyl}-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | SA87-0170 |
| Compound Name: | 1,3-dimethyl-N-{[5-oxo-4-(2-phenylethyl)morpholin-2-yl]methyl}-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 356.42 |
| Molecular Formula: | C19 H24 N4 O3 |
| Smiles: | Cc1cc(C(NCC2CN(CCc3ccccc3)C(CO2)=O)=O)n(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.1596 |
| logD: | 0.1596 |
| logSw: | -1.8344 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.377 |
| InChI Key: | PCLXNYJCHYTUKE-MRXNPFEDSA-N |