3-[3-(2-fluorophenyl)-1,2-oxazol-4-yl]-N-{[4-(2-methoxyethyl)-5-oxomorpholin-2-yl]methyl}propanamide
Chemical Structure Depiction of
3-[3-(2-fluorophenyl)-1,2-oxazol-4-yl]-N-{[4-(2-methoxyethyl)-5-oxomorpholin-2-yl]methyl}propanamide
3-[3-(2-fluorophenyl)-1,2-oxazol-4-yl]-N-{[4-(2-methoxyethyl)-5-oxomorpholin-2-yl]methyl}propanamide
Compound characteristics
| Compound ID: | SA87-1007 |
| Compound Name: | 3-[3-(2-fluorophenyl)-1,2-oxazol-4-yl]-N-{[4-(2-methoxyethyl)-5-oxomorpholin-2-yl]methyl}propanamide |
| Molecular Weight: | 405.42 |
| Molecular Formula: | C20 H24 F N3 O5 |
| Smiles: | COCCN1CC(CNC(CCc2conc2c2ccccc2F)=O)OCC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.4005 |
| logD: | 0.4005 |
| logSw: | -2.1502 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.454 |
| InChI Key: | DTVHQAUYQRIHNA-HNNXBMFYSA-N |