N-(2-{[1-(cyclopropanecarbonyl)piperidin-3-yl](oxan-4-yl)amino}ethyl)-1,5-dimethyl-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
N-(2-{[1-(cyclopropanecarbonyl)piperidin-3-yl](oxan-4-yl)amino}ethyl)-1,5-dimethyl-1H-pyrazole-3-carboxamide
N-(2-{[1-(cyclopropanecarbonyl)piperidin-3-yl](oxan-4-yl)amino}ethyl)-1,5-dimethyl-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | SB03-0278 |
| Compound Name: | N-(2-{[1-(cyclopropanecarbonyl)piperidin-3-yl](oxan-4-yl)amino}ethyl)-1,5-dimethyl-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 417.55 |
| Molecular Formula: | C22 H35 N5 O3 |
| Smiles: | Cc1cc(C(NCCN(C2CCOCC2)C2CCCN(C2)C(C2CC2)=O)=O)nn1C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.7598 |
| logD: | -0.0043 |
| logSw: | -1.5913 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.872 |
| InChI Key: | AGUCOCMSTDMNNV-IBGZPJMESA-N |