1-{7-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7-azaspiro[3.5]nonan-1-yl}-N,N-dimethyl-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
1-{7-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7-azaspiro[3.5]nonan-1-yl}-N,N-dimethyl-1H-1,2,3-triazole-4-carboxamide
1-{7-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7-azaspiro[3.5]nonan-1-yl}-N,N-dimethyl-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | SB24-0359 |
| Compound Name: | 1-{7-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7-azaspiro[3.5]nonan-1-yl}-N,N-dimethyl-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 372.47 |
| Molecular Formula: | C19 H28 N6 O2 |
| Smiles: | Cc1c(CN2CCC3(CCC3n3cc(C(N(C)C)=O)nn3)CC2)c(C)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.3941 |
| logD: | -1.866 |
| logSw: | -0.2679 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 67.733 |
| InChI Key: | XPIOXKUHEPMLSX-KRWDZBQOSA-N |