9-benzyl-6-[1-(thiophene-3-carbonyl)piperidin-4-yl]-2-oxa-6,9-diazaspiro[4.5]decan-8-one
Chemical Structure Depiction of
9-benzyl-6-[1-(thiophene-3-carbonyl)piperidin-4-yl]-2-oxa-6,9-diazaspiro[4.5]decan-8-one
9-benzyl-6-[1-(thiophene-3-carbonyl)piperidin-4-yl]-2-oxa-6,9-diazaspiro[4.5]decan-8-one
Compound characteristics
| Compound ID: | SB27-0693 |
| Compound Name: | 9-benzyl-6-[1-(thiophene-3-carbonyl)piperidin-4-yl]-2-oxa-6,9-diazaspiro[4.5]decan-8-one |
| Molecular Weight: | 439.58 |
| Molecular Formula: | C24 H29 N3 O3 S |
| Smiles: | C1CN(CCC1N1CC(N(Cc2ccccc2)CC12CCOC2)=O)C(c1ccsc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.383 |
| logD: | 2.3765 |
| logSw: | -2.4456 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.743 |
| InChI Key: | SZIMXXQLCUGDGP-XMMPIXPASA-N |