[rel-(3R,4R)-3-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)-4-(fluoromethyl)pyrrolidin-1-yl](2,5-difluorophenyl)methanone
Chemical Structure Depiction of
[rel-(3R,4R)-3-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)-4-(fluoromethyl)pyrrolidin-1-yl](2,5-difluorophenyl)methanone
[rel-(3R,4R)-3-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)-4-(fluoromethyl)pyrrolidin-1-yl](2,5-difluorophenyl)methanone
Compound characteristics
| Compound ID: | SB34-0249 |
| Compound Name: | [rel-(3R,4R)-3-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)-4-(fluoromethyl)pyrrolidin-1-yl](2,5-difluorophenyl)methanone |
| Molecular Weight: | 392.42 |
| Molecular Formula: | C20 H23 F3 N4 O |
| Smiles: | C1CCC(CC1)c1nc([C@@H]2CN(C[C@H]2CF)C(c2cc(ccc2F)F)=O)[nH]n1 |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 3.691 |
| logD: | 3.6899 |
| logSw: | -3.8428 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.825 |
| InChI Key: | SWSWLCLNDBNMDP-CZUORRHYSA-N |