N-{7-oxo-10-[(pyridin-3-yl)methyl]-6,10-diazaspiro[4.6]undecan-8-yl}methanesulfonamide
Chemical Structure Depiction of
N-{7-oxo-10-[(pyridin-3-yl)methyl]-6,10-diazaspiro[4.6]undecan-8-yl}methanesulfonamide
N-{7-oxo-10-[(pyridin-3-yl)methyl]-6,10-diazaspiro[4.6]undecan-8-yl}methanesulfonamide
Compound characteristics
| Compound ID: | SB39-0877 |
| Compound Name: | N-{7-oxo-10-[(pyridin-3-yl)methyl]-6,10-diazaspiro[4.6]undecan-8-yl}methanesulfonamide |
| Molecular Weight: | 352.45 |
| Molecular Formula: | C16 H24 N4 O3 S |
| Smiles: | CS(NC1CN(Cc2cccnc2)CC2(CCCC2)NC1=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.3881 |
| logD: | -0.3884 |
| logSw: | -1.6947 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.683 |
| InChI Key: | WMWOUWXZEXEHDY-AWEZNQCLSA-N |