1-[2-(furan-3-carbonyl)-8-(3-methyl-1,2,4-oxadiazol-5-yl)-2,6-diazaspiro[3.4]octan-6-yl]-2-methoxyethan-1-one
Chemical Structure Depiction of
1-[2-(furan-3-carbonyl)-8-(3-methyl-1,2,4-oxadiazol-5-yl)-2,6-diazaspiro[3.4]octan-6-yl]-2-methoxyethan-1-one
1-[2-(furan-3-carbonyl)-8-(3-methyl-1,2,4-oxadiazol-5-yl)-2,6-diazaspiro[3.4]octan-6-yl]-2-methoxyethan-1-one
Compound characteristics
| Compound ID: | SB57-0231 |
| Compound Name: | 1-[2-(furan-3-carbonyl)-8-(3-methyl-1,2,4-oxadiazol-5-yl)-2,6-diazaspiro[3.4]octan-6-yl]-2-methoxyethan-1-one |
| Molecular Weight: | 360.37 |
| Molecular Formula: | C17 H20 N4 O5 |
| Smiles: | Cc1nc(C2CN(CC23CN(C3)C(c2ccoc2)=O)C(COC)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.3341 |
| logD: | -0.3341 |
| logSw: | -1.3902 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 80.956 |
| InChI Key: | UIONJUMLMOHOJP-CYBMUJFWSA-N |