1-[6-benzyl-8-(4-methyl-4H-1,2,4-triazol-3-yl)-2,6-diazaspiro[3.4]octan-2-yl]-3-phenylpropan-1-one
Chemical Structure Depiction of
1-[6-benzyl-8-(4-methyl-4H-1,2,4-triazol-3-yl)-2,6-diazaspiro[3.4]octan-2-yl]-3-phenylpropan-1-one
1-[6-benzyl-8-(4-methyl-4H-1,2,4-triazol-3-yl)-2,6-diazaspiro[3.4]octan-2-yl]-3-phenylpropan-1-one
Compound characteristics
| Compound ID: | SB59-0620 |
| Compound Name: | 1-[6-benzyl-8-(4-methyl-4H-1,2,4-triazol-3-yl)-2,6-diazaspiro[3.4]octan-2-yl]-3-phenylpropan-1-one |
| Molecular Weight: | 415.54 |
| Molecular Formula: | C25 H29 N5 O |
| Smiles: | Cn1cnnc1C1CN(Cc2ccccc2)CC12CN(C2)C(CCc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3129 |
| logD: | -1.0952 |
| logSw: | -2.4072 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.163 |
| InChI Key: | VIIWZJOZPSLQAY-JOCHJYFZSA-N |