[2-(3,4-dihydroisoquinoline-2(1H)-carbonyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-5(4H)-yl](3-fluoro-4-methoxyphenyl)methanone
Chemical Structure Depiction of
[2-(3,4-dihydroisoquinoline-2(1H)-carbonyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-5(4H)-yl](3-fluoro-4-methoxyphenyl)methanone
[2-(3,4-dihydroisoquinoline-2(1H)-carbonyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-5(4H)-yl](3-fluoro-4-methoxyphenyl)methanone
Compound characteristics
| Compound ID: | SB71-0436 |
| Compound Name: | [2-(3,4-dihydroisoquinoline-2(1H)-carbonyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-5(4H)-yl](3-fluoro-4-methoxyphenyl)methanone |
| Molecular Weight: | 434.47 |
| Molecular Formula: | C24 H23 F N4 O3 |
| Smiles: | COc1ccc(cc1F)C(N1CCn2c(C1)cc(C(N1CCc3ccccc3C1)=O)n2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4175 |
| logD: | 2.4175 |
| logSw: | -2.7692 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.298 |
| InChI Key: | HLDAPYMLNCJRNF-UHFFFAOYSA-N |