7-benzyl-11-(1-methyl-1H-pyrrole-2-carbonyl)-7,11,14-triazaspiro[5.10]hexadecan-15-one
Chemical Structure Depiction of
7-benzyl-11-(1-methyl-1H-pyrrole-2-carbonyl)-7,11,14-triazaspiro[5.10]hexadecan-15-one
7-benzyl-11-(1-methyl-1H-pyrrole-2-carbonyl)-7,11,14-triazaspiro[5.10]hexadecan-15-one
Compound characteristics
| Compound ID: | SB80-0417 |
| Compound Name: | 7-benzyl-11-(1-methyl-1H-pyrrole-2-carbonyl)-7,11,14-triazaspiro[5.10]hexadecan-15-one |
| Molecular Weight: | 436.6 |
| Molecular Formula: | C26 H36 N4 O2 |
| Smiles: | Cn1cccc1C(N1CCCN(Cc2ccccc2)C2(CCCCC2)CC(NCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3598 |
| logD: | 2.7905 |
| logSw: | -3.4094 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.765 |
| InChI Key: | NCFCQWCKMJOVEB-UHFFFAOYSA-N |