N-[1-(cyclopentanecarbonyl)-3-(2-methoxyethyl)pyrrolidin-3-yl]-4-fluorobenzamide
Chemical Structure Depiction of
N-[1-(cyclopentanecarbonyl)-3-(2-methoxyethyl)pyrrolidin-3-yl]-4-fluorobenzamide
N-[1-(cyclopentanecarbonyl)-3-(2-methoxyethyl)pyrrolidin-3-yl]-4-fluorobenzamide
Compound characteristics
| Compound ID: | SC02-0044 |
| Compound Name: | N-[1-(cyclopentanecarbonyl)-3-(2-methoxyethyl)pyrrolidin-3-yl]-4-fluorobenzamide |
| Molecular Weight: | 362.44 |
| Molecular Formula: | C20 H27 F N2 O3 |
| Smiles: | COCCC1(CCN(C1)C(C1CCCC1)=O)NC(c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6294 |
| logD: | 2.6294 |
| logSw: | -3.0159 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.35 |
| InChI Key: | XLHYWAPAQLDLHP-HXUWFJFHSA-N |