{3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethoxy]piperidin-1-yl}(thiophen-3-yl)methanone
Chemical Structure Depiction of
{3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethoxy]piperidin-1-yl}(thiophen-3-yl)methanone
{3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethoxy]piperidin-1-yl}(thiophen-3-yl)methanone
Compound characteristics
| Compound ID: | SC04-0064 |
| Compound Name: | {3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethoxy]piperidin-1-yl}(thiophen-3-yl)methanone |
| Molecular Weight: | 321.4 |
| Molecular Formula: | C15 H19 N3 O3 S |
| Smiles: | Cc1nc(CCOC2CCCN(C2)C(c2ccsc2)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.4168 |
| logD: | 1.4168 |
| logSw: | -2.0412 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.666 |
| InChI Key: | SZPUCJUGCWQNKT-ZDUSSCGKSA-N |