3-(3-methoxyphenyl)-1-{3-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethoxy]piperidin-1-yl}propan-1-one
Chemical Structure Depiction of
3-(3-methoxyphenyl)-1-{3-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethoxy]piperidin-1-yl}propan-1-one
3-(3-methoxyphenyl)-1-{3-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethoxy]piperidin-1-yl}propan-1-one
Compound characteristics
| Compound ID: | SC04-0266 |
| Compound Name: | 3-(3-methoxyphenyl)-1-{3-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethoxy]piperidin-1-yl}propan-1-one |
| Molecular Weight: | 435.52 |
| Molecular Formula: | C25 H29 N3 O4 |
| Smiles: | COc1cccc(CCC(N2CCCC(C2)OCCc2nc(c3ccccc3)on2)=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7476 |
| logD: | 3.7476 |
| logSw: | -4.0312 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.165 |
| InChI Key: | PAQCFFFAAYAZCA-QFIPXVFZSA-N |