1-(ethanesulfonyl)-3-{2-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]ethoxy}piperidine
Chemical Structure Depiction of
1-(ethanesulfonyl)-3-{2-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]ethoxy}piperidine
1-(ethanesulfonyl)-3-{2-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]ethoxy}piperidine
Compound characteristics
| Compound ID: | SC04-0803 |
| Compound Name: | 1-(ethanesulfonyl)-3-{2-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]ethoxy}piperidine |
| Molecular Weight: | 333.4 |
| Molecular Formula: | C13 H23 N3 O5 S |
| Smiles: | CCS(N1CCCC(C1)OCCc1nc(COC)on1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.1819 |
| logD: | 0.1819 |
| logSw: | -1.0886 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 79.738 |
| InChI Key: | ZKATUNMAHJZDJG-NSHDSACASA-N |