2-[(2-chloro-4-fluorophenyl)methyl]-N-(2,2-difluoroethyl)-3-oxo-2,3,5,6,7,8-hexahydro[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide
Chemical Structure Depiction of
2-[(2-chloro-4-fluorophenyl)methyl]-N-(2,2-difluoroethyl)-3-oxo-2,3,5,6,7,8-hexahydro[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide
2-[(2-chloro-4-fluorophenyl)methyl]-N-(2,2-difluoroethyl)-3-oxo-2,3,5,6,7,8-hexahydro[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide
Compound characteristics
| Compound ID: | SC27-2260 |
| Compound Name: | 2-[(2-chloro-4-fluorophenyl)methyl]-N-(2,2-difluoroethyl)-3-oxo-2,3,5,6,7,8-hexahydro[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| Molecular Weight: | 388.77 |
| Molecular Formula: | C16 H16 Cl F3 N4 O2 |
| Smiles: | C1CC(C2=NN(Cc3ccc(cc3[Cl])F)C(N2C1)=O)C(NCC(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5672 |
| logD: | 2.5672 |
| logSw: | -3.3615 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.89 |
| InChI Key: | SXPGBICBJLQINV-LLVKDONJSA-N |