(1-ethyl-1H-pyrazol-5-yl)[3'-(methoxymethyl)-4'H,7'H-spiro[piperidine-4,6'-[1,2,3]triazolo[5,1-c][1,4]oxazin]-1-yl]methanone
Chemical Structure Depiction of
(1-ethyl-1H-pyrazol-5-yl)[3'-(methoxymethyl)-4'H,7'H-spiro[piperidine-4,6'-[1,2,3]triazolo[5,1-c][1,4]oxazin]-1-yl]methanone
(1-ethyl-1H-pyrazol-5-yl)[3'-(methoxymethyl)-4'H,7'H-spiro[piperidine-4,6'-[1,2,3]triazolo[5,1-c][1,4]oxazin]-1-yl]methanone
Compound characteristics
| Compound ID: | SC40-0154 |
| Compound Name: | (1-ethyl-1H-pyrazol-5-yl)[3'-(methoxymethyl)-4'H,7'H-spiro[piperidine-4,6'-[1,2,3]triazolo[5,1-c][1,4]oxazin]-1-yl]methanone |
| Molecular Weight: | 360.41 |
| Molecular Formula: | C17 H24 N6 O3 |
| Smiles: | CCn1c(ccn1)C(N1CCC2(CC1)Cn1c(CO2)c(COC)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | -0.481 |
| logD: | -0.481 |
| logSw: | -1.2819 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 72.243 |
| InChI Key: | YOLSOIZYAFMORV-UHFFFAOYSA-N |