3-{1-[(4-chlorophenyl)methanesulfonyl]-3-fluoropyrrolidin-3-yl}-5-phenyl-1,2,4-oxadiazole
Chemical Structure Depiction of
3-{1-[(4-chlorophenyl)methanesulfonyl]-3-fluoropyrrolidin-3-yl}-5-phenyl-1,2,4-oxadiazole
3-{1-[(4-chlorophenyl)methanesulfonyl]-3-fluoropyrrolidin-3-yl}-5-phenyl-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | SC41-0132 |
| Compound Name: | 3-{1-[(4-chlorophenyl)methanesulfonyl]-3-fluoropyrrolidin-3-yl}-5-phenyl-1,2,4-oxadiazole |
| Molecular Weight: | 421.88 |
| Molecular Formula: | C19 H17 Cl F N3 O3 S |
| Smiles: | C1CN(CC1(c1nc(c2ccccc2)on1)F)S(Cc1ccc(cc1)[Cl])(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9859 |
| logD: | 3.9859 |
| logSw: | -4.6188 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.549 |
| InChI Key: | CGBRDMUAGNJTAV-IBGZPJMESA-N |