(4-{[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl}-1-oxa-9-azaspiro[5.5]undecan-9-yl)(1,3-thiazol-4-yl)methanone
Chemical Structure Depiction of
(4-{[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl}-1-oxa-9-azaspiro[5.5]undecan-9-yl)(1,3-thiazol-4-yl)methanone
(4-{[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl}-1-oxa-9-azaspiro[5.5]undecan-9-yl)(1,3-thiazol-4-yl)methanone
Compound characteristics
| Compound ID: | SC42-0630 |
| Compound Name: | (4-{[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl}-1-oxa-9-azaspiro[5.5]undecan-9-yl)(1,3-thiazol-4-yl)methanone |
| Molecular Weight: | 392.48 |
| Molecular Formula: | C18 H24 N4 O4 S |
| Smiles: | COCc1nc(CC2CCOC3(CCN(CC3)C(c3cscn3)=O)C2)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.6564 |
| logD: | 1.6564 |
| logSw: | -2.0791 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 73.874 |
| InChI Key: | GBENNGOEQXKDCB-ZDUSSCGKSA-N |