[4-(2-ethoxyethoxy)-1-oxa-9-azaspiro[5.5]undecan-9-yl](1,3-oxazol-5-yl)methanone
Chemical Structure Depiction of
[4-(2-ethoxyethoxy)-1-oxa-9-azaspiro[5.5]undecan-9-yl](1,3-oxazol-5-yl)methanone
[4-(2-ethoxyethoxy)-1-oxa-9-azaspiro[5.5]undecan-9-yl](1,3-oxazol-5-yl)methanone
Compound characteristics
| Compound ID: | SC43-0256 |
| Compound Name: | [4-(2-ethoxyethoxy)-1-oxa-9-azaspiro[5.5]undecan-9-yl](1,3-oxazol-5-yl)methanone |
| Molecular Weight: | 338.4 |
| Molecular Formula: | C17 H26 N2 O5 |
| Smiles: | CCOCCOC1CCOC2(CCN(CC2)C(c2cnco2)=O)C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.4224 |
| logD: | 0.4224 |
| logSw: | -0.6438 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 56.972 |
| InChI Key: | PUPSPDLZUDYCNY-CQSZACIVSA-N |