1-{4-[2-(benzyloxy)ethoxy]-1-oxa-9-azaspiro[5.5]undecan-9-yl}-2-phenoxyethan-1-one
Chemical Structure Depiction of
1-{4-[2-(benzyloxy)ethoxy]-1-oxa-9-azaspiro[5.5]undecan-9-yl}-2-phenoxyethan-1-one
1-{4-[2-(benzyloxy)ethoxy]-1-oxa-9-azaspiro[5.5]undecan-9-yl}-2-phenoxyethan-1-one
Compound characteristics
| Compound ID: | SC43-0696 |
| Compound Name: | 1-{4-[2-(benzyloxy)ethoxy]-1-oxa-9-azaspiro[5.5]undecan-9-yl}-2-phenoxyethan-1-one |
| Molecular Weight: | 439.55 |
| Molecular Formula: | C26 H33 N O5 |
| Smiles: | C1COC2(CCN(CC2)C(COc2ccccc2)=O)CC1OCCOCc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6521 |
| logD: | 2.6521 |
| logSw: | -2.6051 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.473 |
| InChI Key: | RYOWSQIRKCRBLX-XMMPIXPASA-N |