3-methyl-N-{[6-oxo-7-(propan-2-yl)-4,5,6,7-tetrahydro[1,2,3]triazolo[1,5-a]pyrazin-3-yl]methyl}thiophene-2-carboxamide
Chemical Structure Depiction of
3-methyl-N-{[6-oxo-7-(propan-2-yl)-4,5,6,7-tetrahydro[1,2,3]triazolo[1,5-a]pyrazin-3-yl]methyl}thiophene-2-carboxamide
3-methyl-N-{[6-oxo-7-(propan-2-yl)-4,5,6,7-tetrahydro[1,2,3]triazolo[1,5-a]pyrazin-3-yl]methyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | SC45-0725 |
| Compound Name: | 3-methyl-N-{[6-oxo-7-(propan-2-yl)-4,5,6,7-tetrahydro[1,2,3]triazolo[1,5-a]pyrazin-3-yl]methyl}thiophene-2-carboxamide |
| Molecular Weight: | 333.41 |
| Molecular Formula: | C15 H19 N5 O2 S |
| Smiles: | CC(C)C1C(NCc2c(CNC(c3c(C)ccs3)=O)nnn12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.2634 |
| logD: | 1.2634 |
| logSw: | -2.1419 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.436 |
| InChI Key: | XTDQQFFJPJJFQO-LBPRGKRZSA-N |