rel-(1R,3S,6R)-5-(benzenesulfonyl)-N~1~-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N~6~-methyl-5-azaspiro[2.4]heptane-1,6-dicarboxamide
Chemical Structure Depiction of
rel-(1R,3S,6R)-5-(benzenesulfonyl)-N~1~-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N~6~-methyl-5-azaspiro[2.4]heptane-1,6-dicarboxamide
rel-(1R,3S,6R)-5-(benzenesulfonyl)-N~1~-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N~6~-methyl-5-azaspiro[2.4]heptane-1,6-dicarboxamide
Compound characteristics
| Compound ID: | SC65-0914 |
| Compound Name: | rel-(1R,3S,6R)-5-(benzenesulfonyl)-N~1~-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N~6~-methyl-5-azaspiro[2.4]heptane-1,6-dicarboxamide |
| Molecular Weight: | 446.52 |
| Molecular Formula: | C21 H26 N4 O5 S |
| Smiles: | [H][C@@]1(C[C@@]12C[C@@H](C(NC)=O)N(C2)S(c1ccccc1)(=O)=O)C(NCc1c(C)noc1C)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 0.4299 |
| logD: | 0.4299 |
| logSw: | -2.3791 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 104.258 |
| InChI Key: | VTBQUBCKESAIIF-WFXMLNOXSA-N |