2-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-4-(4-methyl-4H-1,2,4-triazol-3-yl)-8-oxa-2-azaspiro[4.5]decane
Chemical Structure Depiction of
2-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-4-(4-methyl-4H-1,2,4-triazol-3-yl)-8-oxa-2-azaspiro[4.5]decane
2-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-4-(4-methyl-4H-1,2,4-triazol-3-yl)-8-oxa-2-azaspiro[4.5]decane
Compound characteristics
| Compound ID: | SC66-0010 |
| Compound Name: | 2-[(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-4-(4-methyl-4H-1,2,4-triazol-3-yl)-8-oxa-2-azaspiro[4.5]decane |
| Molecular Weight: | 370.45 |
| Molecular Formula: | C20 H26 N4 O3 |
| Smiles: | Cn1cnnc1C1CN(Cc2ccc3c(c2)OCCO3)CC12CCOCC2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.319 |
| logD: | -2.8322 |
| logSw: | -1.6037 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.768 |
| InChI Key: | SMSLLPFWGSVYFK-INIZCTEOSA-N |