(5-bromofuran-2-yl)[4-(4-ethyl-4H-1,2,4-triazol-3-yl)-2-azaspiro[4.4]nonan-2-yl]methanone
Chemical Structure Depiction of
(5-bromofuran-2-yl)[4-(4-ethyl-4H-1,2,4-triazol-3-yl)-2-azaspiro[4.4]nonan-2-yl]methanone
(5-bromofuran-2-yl)[4-(4-ethyl-4H-1,2,4-triazol-3-yl)-2-azaspiro[4.4]nonan-2-yl]methanone
Compound characteristics
| Compound ID: | SC69-0553 |
| Compound Name: | (5-bromofuran-2-yl)[4-(4-ethyl-4H-1,2,4-triazol-3-yl)-2-azaspiro[4.4]nonan-2-yl]methanone |
| Molecular Weight: | 393.28 |
| Molecular Formula: | C17 H21 Br N4 O2 |
| Smiles: | CCn1cnnc1C1CN(CC12CCCC2)C(c1ccc(o1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9891 |
| logD: | 1.9891 |
| logSw: | -2.2261 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 50.413 |
| InChI Key: | DZSZJBVIJQKKRE-LBPRGKRZSA-N |