1-(2'-cyclopropyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)-2-ethylbutan-1-one
Chemical Structure Depiction of
1-(2'-cyclopropyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)-2-ethylbutan-1-one
1-(2'-cyclopropyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)-2-ethylbutan-1-one
Compound characteristics
| Compound ID: | SC72-0348 |
| Compound Name: | 1-(2'-cyclopropyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)-2-ethylbutan-1-one |
| Molecular Weight: | 301.39 |
| Molecular Formula: | C17 H23 N3 O2 |
| Smiles: | CCC(CC)C(N1CC2(C1)c1cnc(C3CC3)nc1CO2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5046 |
| logD: | 2.5044 |
| logSw: | -2.3968 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.012 |
| InChI Key: | ZRVVYTURWOOBKY-UHFFFAOYSA-N |