1-(2'-cyclohexyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)-2-cyclopropylethan-1-one
Chemical Structure Depiction of
1-(2'-cyclohexyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)-2-cyclopropylethan-1-one
1-(2'-cyclohexyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)-2-cyclopropylethan-1-one
Compound characteristics
| Compound ID: | SC72-0411 |
| Compound Name: | 1-(2'-cyclohexyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)-2-cyclopropylethan-1-one |
| Molecular Weight: | 327.42 |
| Molecular Formula: | C19 H25 N3 O2 |
| Smiles: | C1CCC(CC1)c1ncc2c(COC23CN(C3)C(CC2CC2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.7147 |
| logD: | 2.7147 |
| logSw: | -2.9685 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.405 |
| InChI Key: | MXSDCXUVRFLCPK-UHFFFAOYSA-N |