[1-(2-methoxyethyl)-2,5-dimethyl-1H-pyrrol-3-yl](2'-phenyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)methanone
Chemical Structure Depiction of
[1-(2-methoxyethyl)-2,5-dimethyl-1H-pyrrol-3-yl](2'-phenyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)methanone
[1-(2-methoxyethyl)-2,5-dimethyl-1H-pyrrol-3-yl](2'-phenyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)methanone
Compound characteristics
| Compound ID: | SC72-0646 |
| Compound Name: | [1-(2-methoxyethyl)-2,5-dimethyl-1H-pyrrol-3-yl](2'-phenyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidin]-1-yl)methanone |
| Molecular Weight: | 418.49 |
| Molecular Formula: | C24 H26 N4 O3 |
| Smiles: | Cc1cc(C(N2CC3(C2)c2cnc(c4ccccc4)nc2CO3)=O)c(C)n1CCOC |
| Stereo: | ACHIRAL |
| logP: | 2.6161 |
| logD: | 2.6161 |
| logSw: | -3.0508 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.731 |
| InChI Key: | OBTIGPFLEUBXLK-UHFFFAOYSA-N |