1-(2-chlorobenzene-1-sulfonyl)-2'-phenyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidine]
Chemical Structure Depiction of
1-(2-chlorobenzene-1-sulfonyl)-2'-phenyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidine]
1-(2-chlorobenzene-1-sulfonyl)-2'-phenyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidine]
Compound characteristics
| Compound ID: | SC72-1983 |
| Compound Name: | 1-(2-chlorobenzene-1-sulfonyl)-2'-phenyl-7'H-spiro[azetidine-3,5'-furo[3,4-d]pyrimidine] |
| Molecular Weight: | 413.88 |
| Molecular Formula: | C20 H16 Cl N3 O3 S |
| Smiles: | C1C2(CN1S(c1ccccc1[Cl])(=O)=O)c1cnc(c3ccccc3)nc1CO2 |
| Stereo: | ACHIRAL |
| logP: | 3.3841 |
| logD: | 3.3841 |
| logSw: | -3.9027 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.28 |
| InChI Key: | BNVACNJDHFJQOB-UHFFFAOYSA-N |