N-(cyclopropylmethyl)-1'-methyl-1-(thiophene-2-carbonyl)-4',7'-dihydro-1'H-spiro[piperidine-4,6'-pyrano[4,3-c]pyrazole]-3'-carboxamide
Chemical Structure Depiction of
N-(cyclopropylmethyl)-1'-methyl-1-(thiophene-2-carbonyl)-4',7'-dihydro-1'H-spiro[piperidine-4,6'-pyrano[4,3-c]pyrazole]-3'-carboxamide
N-(cyclopropylmethyl)-1'-methyl-1-(thiophene-2-carbonyl)-4',7'-dihydro-1'H-spiro[piperidine-4,6'-pyrano[4,3-c]pyrazole]-3'-carboxamide
Compound characteristics
| Compound ID: | SC73-0572 |
| Compound Name: | N-(cyclopropylmethyl)-1'-methyl-1-(thiophene-2-carbonyl)-4',7'-dihydro-1'H-spiro[piperidine-4,6'-pyrano[4,3-c]pyrazole]-3'-carboxamide |
| Molecular Weight: | 414.53 |
| Molecular Formula: | C21 H26 N4 O3 S |
| Smiles: | Cn1c2CC3(CCN(CC3)C(c3cccs3)=O)OCc2c(C(NCC2CC2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 1.748 |
| logD: | 1.748 |
| logSw: | -2.344 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.688 |
| InChI Key: | NFWMSFXIZICQMI-UHFFFAOYSA-N |